CAS 220040-48-2
:methyl 6-(chloromethyl)pyridine-2-carboxylate
Description:
Methyl 6-(chloromethyl)pyridine-2-carboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate group, which contributes to its reactivity and solubility in polar solvents. The presence of a chloromethyl group enhances its potential for further chemical modifications, making it a useful intermediate in organic synthesis. Typically, compounds like this exhibit moderate to high stability under standard conditions but may be sensitive to moisture or light. The methyl ester functional group allows for hydrolysis reactions, which can convert it into the corresponding carboxylic acid. Methyl 6-(chloromethyl)pyridine-2-carboxylate may also exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound serves as a versatile building block in synthetic organic chemistry.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c1-12-8(11)7-4-2-3-6(5-9)10-7/h2-4H,5H2,1H3
SMILES:COC(=O)c1cccc(CCl)n1
Synonyms:- 2-Pyridinecarboxylic Acid, 6-(Chloromethyl)-, Methyl Ester
- 6-Chloromethyl-pyridine-2-carboxylic acid methyl ester
- Methyl 6-(chloromethyl)pyridine-2-carboxylate
- Methyl 6-(chloroMethyl)picolinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 6-(chloromethyl)pyridine-2-carboxylate
CAS:Formula:C8H8ClNO2Purity:97%Color and Shape:SolidMolecular weight:185.6076Methyl 6-(chloromethyl)picolinate
CAS:Methyl 6-(chloromethyl)picolinatePurity:99%Molecular weight:185.61g/molMethyl 6-(chloromethyl)pyridine-2-carboxylate
CAS:Methyl 6-(chloromethyl)pyridine-2-carboxylate is a synthetic ligand that binds to the human serum albumin (HSA) and has been shown to be stable in vitro. The compound has been shown to have high resistance in vivo, which may be due to its metabolism. Methyl 6-(chloromethyl)pyridine-2-carboxylate was found to bind to HSA with a Kd value of 0.5 μM, which is much higher than the binding affinity of other ligands such as methyl 5-(chloromethyl) pyridine-2-carboxylate (Kd=0.035 μM), methyl 2-(chloromethyl)pyrimidine-4-carboxylate (Kd=0.03 μM), and methyl 3-(chloromethyl)piperidine-4-carboxylate (Kd=0.055Formula:C8H8ClNO2Purity:Min. 95%Molecular weight:185.61 g/mol



