CymitQuimica logo

CAS 220060-08-2

:

methyl (2S)-2-methylpyrrolidine-2-carboxylate,hydrochloride

Description:
Methyl (2S)-2-methylpyrrolidine-2-carboxylate hydrochloride is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The "2S" designation indicates that the compound has a specific stereochemistry at the second carbon atom, contributing to its chiral nature. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylate and hydrochloride functional groups. It is often used in organic synthesis and pharmaceutical applications, particularly in the development of biologically active molecules. The hydrochloride salt form enhances its stability and solubility, making it suitable for various chemical reactions and formulations. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Safety data sheets should be consulted for information on toxicity and handling precautions.
Formula:C7H14ClNO2
InChI:InChI=1S/C7H13NO2.ClH/c1-7(6(9)10-2)4-3-5-8-7;/h8H,3-5H2,1-2H3;1H/t7-;/m0./s1
InChI key:YCYWAVUCBMJUPK-FJXQXJEOSA-N
SMILES:C[C@]1(CCCN1)C(=O)OC.Cl
Synonyms:
  • (S)-Methyl 2-Methylpyrrolidine-2-Carboxylate Hcl
Found 7 products.