CAS 22007-68-7

(1Z)-2-methylpropanimidamide

Description:

(1Z)-2-methylpropanimidamide, with the CAS number 22007-68-7, is an organic compound characterized by its amine functional group and a branched alkyl structure. This substance features a propanimidamide backbone, where the imidamide group is attached to a 2-methyl substituent, giving it unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in organic synthesis and medicinal chemistry, particularly as a building block for various pharmaceuticals. Its structure allows for hydrogen bonding, which can influence its solubility and reactivity in different solvents. Additionally, (1Z)-2-methylpropanimidamide may exhibit biological activity, making it of interest in research related to drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₄H₁₀N₂

InChI: InChI=1/C4H10N2/c1-3(2)4(5)6/h3H,1-2H3,(H3,5,6)

SMILES: CC(C)C(=N)N

2-Methylpropanimidamide hydrochloride

CAS: 22007-68-7

Formula: C₄H₁₁ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 122.5965

Ref: IN-DA00BD72

Isobutanamidine hydrochloride

CAS: 22007-68-7

Isobutanamidine hydrochloride

Formula: C₄H₁₀N₂·ClH

Purity: ≥95%

Color and Shape: white crystalline solid

Molecular weight: 122.60g/mol

Ref: 54-OR27276

iso-Propylcarbamidine hydrochloride

CAS: 22007-68-7

Formula: C₄H₁₁ClN₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 122.6

Ref: 10-F017191