CAS 22008-60-2
:N-formyl-L-methionyl-L-phenylalanine
Description:
N-formyl-L-methionyl-L-phenylalanine, with the CAS number 22008-60-2, is a synthetic peptide that consists of the amino acids methionine and phenylalanine, with a formyl group attached to the amino terminus of the methionine residue. This compound is characterized by its unique structure, which influences its biochemical properties and interactions. It is typically used in research settings, particularly in studies related to peptide synthesis, protein folding, and the development of peptide-based therapeutics. The presence of the formyl group can affect the peptide's stability, solubility, and biological activity. Additionally, the incorporation of specific amino acids like methionine and phenylalanine can impart unique properties, such as hydrophobicity and potential interactions with biological receptors. As with many peptides, its behavior in solution can be influenced by factors such as pH, temperature, and ionic strength, making it an interesting subject for further investigation in biochemistry and molecular biology.
Formula:C15H20N2O4S
InChI:InChI=1/C15H20N2O4S/c1-22-8-7-12(16-10-18)14(19)17-13(15(20)21)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3,(H,16,18)(H,17,19)(H,20,21)/t12-,13-/m0/s1
SMILES:CSCC[C@@H](C(=N[C@@H](Cc1ccccc1)C(=O)O)O)N=CO
Synonyms:- For-Met-Phe-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
For-Met-Phe-OH
CAS:<p>For-Met-Phe-OH is a synthetic peptide that mimics the amino acid sequence of the human body's natural collagen. It is used as a building block for developing collagen gels, which are used in clinical pathology to identify and quantify cells. For-Met-Phe-OH has been shown to stimulate colony-stimulating factor, which regulates cell proliferation and differentiation. This peptide also plays a role in cell signaling pathways that regulate cell growth and differentiation. For-Met-Phe-OH has been shown to have anti-inflammatory effects by inhibiting the production of inflammatory cytokines.</p>Formula:C15H20N2O4SPurity:Min. 95%Molecular weight:324.4 g/mol
