CAS 220088-42-6
:N'-[1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide
Description:
N'-[1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a cyano group, and a dimethylimidoformamide moiety. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique electronic properties and potential reactivity. This compound is likely to exhibit polar characteristics due to the imidoformamide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. The compound's stability, solubility, and reactivity would depend on the specific conditions, such as pH and solvent, making it important for researchers to consider these factors in practical applications. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry.
Formula:C13H11ClFN5
InChI:InChI=1/C13H11ClFN5/c1-19(2)8-17-13-9(6-16)7-18-20(13)10-3-4-12(15)11(14)5-10/h3-5,7-8H,1-2H3/b17-8+
Synonyms:- Binucleine 2 - CAS 220088-42-6 - Calbiochem
- N'-[2-(3-chloro-4-fluorophenyl)-4-cyanopyrazol-3-yl]-N,N-dimethylmethanimidamide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Binucleine 2
CAS:Binucleine 2: Drosophila Aurora B kinase inhibitor (Ki=0.36μM), dose-dependent, minimal effect on human/X. laevis kinases, disrupts mitosis in fly cells.Formula:C13H11ClFN5Color and Shape:SolidMolecular weight:291.71


