CAS 220088-42-6

N'-[1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide

Description:

N'-[1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a cyano group, and a dimethylimidoformamide moiety. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique electronic properties and potential reactivity. This compound is likely to exhibit polar characteristics due to the imidoformamide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. The compound's stability, solubility, and reactivity would depend on the specific conditions, such as pH and solvent, making it important for researchers to consider these factors in practical applications. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry.

Formula: C₁₃H₁₁ClFN₅

InChI: InChI=1/C13H11ClFN5/c1-19(2)8-17-13-9(6-16)7-18-20(13)10-3-4-12(15)11(14)5-10/h3-5,7-8H,1-2H3/b17-8+

Synonyms:

• Binucleine 2 - CAS 220088-42-6 - Calbiochem
• N'-[2-(3-chloro-4-fluorophenyl)-4-cyanopyrazol-3-yl]-N,N-dimethylmethanimidamide

Binucleine 2

CAS: 220088-42-6

Formula: C₁₃H₁₁N₅ClF

Molecular weight: 291.71

Ref: 7W-GK7674

Binucleine 2

CAS: 220088-42-6

Formula: C₁₃H₁₁ClFN₅

Molecular weight: 291.71

Ref: 4Z-B-158001

Binucleine 2

CAS: 220088-42-6

Binucleine 2: Drosophila Aurora B kinase inhibitor (Ki=0.36μM), dose-dependent, minimal effect on human/X. laevis kinases, disrupts mitosis in fly cells.

Formula: C₁₃H₁₁ClFN₅

Color and Shape: Solid

Molecular weight: 291.71

Ref: TM-T36801