CAS 220099-91-2
:(2′R)-Spiro[1-azabicyclo[2.2.2]octane-3,2′(3′H)-furo[2,3-b]pyridine]
Description:
(2′R)-Spiro[1-azabicyclo[2.2.2]octane-3,2′(3′H)-furo[2,3-b]pyridine] is a complex organic compound characterized by its unique spirocyclic structure, which combines a bicyclic framework with a furo[2,3-b]pyridine moiety. This compound features a nitrogen atom within its bicyclic system, contributing to its potential biological activity. The presence of the furo-pyridine structure suggests that it may exhibit interesting electronic properties and reactivity due to the conjugated system. Additionally, the stereochemistry indicated by the (2′R) designation implies specific spatial arrangements of atoms, which can significantly influence the compound's interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The CAS number 220099-91-2 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, this compound's structural features suggest it may have relevance in various fields, including drug discovery and development.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c1-2-10-8-13(16-12(10)14-5-1)9-15-6-3-11(13)4-7-15/h1-2,5,11H,3-4,6-9H2/t13-/m0/s1
InChI key:InChIKey=OCKIPDMKGPYYJS-ZDUSSCGKSA-N
SMILES:[C@]12(C3CCN(C1)CC3)CC=4C(O2)=NC=CC4
Synonyms:- AZD0328
- Spiro[1-azabicyclo[2.2.2]octane-3,2′(3′H)-furo[2,3-b]pyridine], (2′R)-
- (2′R)-Spiro[1-azabicyclo[2.2.2]octane-3,2′(3′H)-furo[2,3-b]pyridine]
- AZD-0328
- AZD 0328
- (2R)-3H-1'-Azaspiro[furo[2,3-b]pyridine-2,3'-bicyclo[2.2.2]octane
- Spiro[1-azabicyclo[2.2.2]octane-3,2'(3'H)-furo[2,3-b]pyridine], (2'R)-
- (R)-6',7'-dihydro-3'H-4-azaspiro[bicyclo[2.2.2]octane-2,2'-furo[2,3-b]pyridine
- 220099-91-2
- UNII-2B218X5QIY
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AZD 0328
CAS:<p>AZD 0328 is a nicotinic receptor agonist for α7 neurons.</p>Formula:C13H16N2OColor and Shape:SolidMolecular weight:216.28
