CAS 22014-99-9
:1-butyl-1H-indole
Description:
1-Butyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The "1-butyl" designation indicates that a butyl group is attached to the nitrogen atom of the indole ring, influencing its solubility and reactivity. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is moderately soluble in organic solvents and has limited solubility in water due to its hydrophobic butyl group. 1-Butyl-1H-indole is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a building block for more complex molecules. Its chemical properties include the ability to participate in electrophilic aromatic substitution reactions, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H15N
InChI:InChI=1/C12H15N/c1-2-3-9-13-10-8-11-6-4-5-7-12(11)13/h4-8,10H,2-3,9H2,1H3
SMILES:CCCCn1ccc2ccccc12
Synonyms:- 1H-indole, 1-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
