CAS 220150-70-9
:Methanesulfonamide,N,N'-(1S,2S)-1,2-cyclohexanediylbis-
Description:
Methanesulfonamide, N,N'-(1S,2S)-1,2-cyclohexanediylbis- is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry, particularly as a scaffold in drug design. The compound features a cyclohexane backbone, which contributes to its three-dimensional structure and can influence its biological activity. The presence of the methanesulfonamide group suggests potential interactions with biological targets, such as enzymes or receptors, due to the sulfonamide's ability to form hydrogen bonds. The stereochemistry indicated by the (1S,2S) configuration implies specific spatial arrangements of atoms, which can significantly affect the compound's reactivity and interactions. This compound may exhibit properties such as solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. However, detailed studies would be necessary to fully understand its physical and chemical properties, as well as its potential applications in various fields.
Formula:C8H18N2O4S2
InChI:InChI=1S/C8H18N2O4S2/c1-15(11,12)9-7-5-3-4-6-8(7)10-16(2,13)14/h7-10H,3-6H2,1-2H3/t7-,8-/m0/s1
InChI key:JUWLQVLCYRNWSV-YUMQZZPRSA-N
SMILES:CS(=O)(=O)N[C@H]1CCCC[C@@H]1NS(=O)(=O)C
Synonyms:- (1S,2S)-1,2-Bis(methanesulfonamido)cyclohexane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery