CAS 22019-49-4
:2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one
Description:
2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one, with the CAS number 22019-49-4, is an organic compound characterized by its complex structure, which includes a bromine atom, a chloro group, and a nitro group attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests it may exhibit significant reactivity due to the presence of electrophilic and nucleophilic sites, making it useful in various chemical reactions, particularly in synthetic organic chemistry. The nitro group can enhance the compound's electrophilicity, while the bromine can serve as a leaving group in substitution reactions. Additionally, the presence of halogens and nitro groups often influences the compound's physical properties, such as melting point and boiling point, as well as its potential applications in pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and the presence of halogenated and nitro functional groups.
Formula:C8H5BrClNO3
InChI:InChI=1/C8H5BrClNO3/c9-4-8(12)5-1-2-6(10)7(3-5)11(13)14/h1-3H,4H2
SMILES:c1cc(c(cc1C(=O)CBr)N(=O)=O)Cl
Synonyms:- 4-Chloro-3-nitrophenacylbromide
- 2-Bromo-1-(4-Chloro-3-Nitrophenyl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-BROMO-1-(4-CHLORO-3-NITROPHENYL)ETHAN-1-ONE
CAS:Formula:C8H5BrClNO3Purity:98%Color and Shape:SolidMolecular weight:278.48724-Chloro-3-nitrophenacyl bromide
CAS:4-Chloro-3-nitrophenacyl bromideFormula:C8H5BrClNO3Purity:techColor and Shape: light orange. crystalline solidMolecular weight:278.49g/mol2-Bromo-1-(4-chloro-3-nitro-phenyl)-ethanone
CAS:Formula:C8H5BrClNO3Purity:98%Molecular weight:278.494-Chloro-3-nitrophenacylbromide
CAS:<p>4-Chloro-3-nitrophenacylbromide is a synthetic compound that has been shown to be effective against cancer cells in vitro. In the presence of light, this substance emits a bright green fluorescence, which is useful for imaging. The synthesis of 4-Chloro-3-nitrophenacylbromide can be achieved by solid phase methods and chemosynthesis. Spirocyclic amines are used as building blocks for the synthesis of this product. This process leads to functionalization strategies with high levels of chirality and drug development.</p>Formula:C8H5BrClNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:278.49 g/mol



