CAS 220210-55-9
:(2,4,5-trichlorophenyl)boronic acid
Description:
(2,4,5-Trichlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with three chlorine atoms at the 2, 4, and 5 positions. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its boronic acid functionality allows it to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in Suzuki coupling reactions. The presence of multiple chlorine substituents enhances its reactivity and can influence its electronic properties, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, (2,4,5-trichlorophenyl)boronic acid may exhibit biological activity, which can be explored in medicinal chemistry. As with many organoboron compounds, proper handling and storage are essential due to potential toxicity and environmental concerns associated with chlorinated compounds.
Formula:C6H4BCl3O2
InChI:InChI=1/C6H4BCl3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,11-12H
SMILES:c1c(c(cc(c1Cl)Cl)Cl)B(O)O
Synonyms:- boronic acid, B-(2,4,5-trichlorophenyl)-
- 2,4,5-Trichlorophenylboronic acid
- (2,4,5-Trichlorophenyl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4,5-Trichlorophenylboronic acid
CAS:Formula:C6H4BCl3O2Purity:97%Color and Shape:SolidMolecular weight:225.26482,4,5-Trichlorophenylboronic acid
CAS:2,4,5-Trichlorophenylboronic acidPurity:97%Molecular weight:225.27g/mol2,4,5-Trichlorophenylboronic acid
CAS:2,4,5-Trichlorophenylboronic acid is a drug substance that is used in the synthesis of imidazole derivatives. It has been shown to induce skin tumor formation when combined with caffeine and midodrine. 2,4,5-Trichlorophenylboronic acid has synergistic effects with other substances such as phorbol esters (e.g., 12-O-tetradecanoylphorbol 13-acetate) or c1-6 alkylating agents (e.g., ethylenimine).Formula:C6H4BCl3O2Purity:Min. 95%Molecular weight:225.26 g/mol



