CAS 220228-03-5

3,4,5-(trifluorophenyl)acetonitrile

Description:

3,4,5-(Trifluorophenyl)acetonitrile is an organic compound characterized by the presence of a trifluoromethyl-substituted phenyl group attached to an acetonitrile moiety. Its molecular structure features a phenyl ring with three fluorine atoms positioned at the 3, 4, and 5 positions, which significantly influences its chemical properties, including increased electronegativity and reactivity. The acetonitrile functional group contributes to its polarity and solubility in polar solvents. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a versatile building block. The presence of fluorine atoms enhances its stability and can affect its biological activity. Additionally, 3,4,5-(trifluorophenyl)acetonitrile may exhibit unique spectral properties, making it useful in analytical chemistry for various applications. Safety data should be consulted, as compounds containing fluorine can pose specific health and environmental risks.

Formula: C₈H₄F₃N

InChI: InChI=1/C8H4F3N/c9-6-3-5(1-2-12)4-7(10)8(6)11/h3-4H,1H2

SMILES: C(C#N)c1cc(c(c(c1)F)F)F

Synonyms:

• 3,4,5-Trifluorobenzyl Cyanide

2-(3,4,5-Trifluorophenyl)acetonitrile

CAS: 220228-03-5

Formula: C₈H₄F₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 171.1193

Ref: IN-DA003BAU

3,4,5-Trifluorophenylacetonitrile

CAS: 220228-03-5

3,4,5-Trifluorophenylacetonitrile

Formula: C₈H₄F₃N

Purity: 97%

Color and Shape: off-white fused solid

Molecular weight: 171.12g/mol

Ref: 54-PC7818O

3,4,5-Trifluorophenylacetonitrile

CAS: 220228-03-5

Formula: C₈H₄F₃N

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.122

Ref: 10-F007701