CAS 220239-68-9

4-Hydroxy-3-(trifluoromethyl)benzoic acid

Description:

4-Hydroxy-3-(trifluoromethyl)benzoic acid, with the CAS number 220239-68-9, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group and a trifluoromethyl group attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance. The hydroxyl group contributes to its acidity, allowing it to participate in various chemical reactions, including esterification and amidation. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical applications. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's reactivity and stability. This substance is soluble in organic solvents and may have limited solubility in water, reflecting its hydrophobic characteristics. Overall, 4-Hydroxy-3-(trifluoromethyl)benzoic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₈H₅F₃O₃

InChI: InChI=1/C8H5F3O3/c9-8(10,11)5-3-4(7(13)14)1-2-6(5)12/h1-3,12H,(H,13,14)

SMILES: c1cc(c(cc1C(=O)O)C(F)(F)F)O

Synonyms:

• Benzoic Acid, 4-Hydroxy-3-(Trifluoromethyl)-

4-Hydroxy-3-(trifluoromethyl)benzoic acid

CAS: 220239-68-9

Formula: C₈H₅F₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.1187

Ref: IN-DA007Q6H

4-Hydroxy-3-(trifluoromethyl)benzoic acid

CAS: 220239-68-9

4-Hydroxy-3-(trifluoromethyl)benzoic acid

Formula: C₈H₅F₃O₃

Purity: ≥95%

Color and Shape: cream powder

Molecular weight: 206.12g/mol

Ref: 54-PC7851

4-Hydroxy-3-(trifluoromethyl)benzoic acid

CAS: 220239-68-9

Formula: C₈H₅F₃O₃

Purity: 98%

Color and Shape: Solid, White to yellow powder

Molecular weight: 206.12

Ref: 10-F013033

4-Hydroxy-3-(trifluoromethyl)benzoic acid

CAS: 220239-68-9

4-Hydroxy-3-(trifluoromethyl)benzoic acid (4OTFB) is a ligand that binds to the inflammatory response receptor complex. The 4OTFB-ligand complex has been shown to inhibit inflammation in animals and humans, which may be due to its ability to inhibit the production of proinflammatory cytokines and suppress the production of reactive oxygen species (ROS). 4OTFB was found to bind strongly to sew2871, a protein that regulates the inflammatory response. However, it did not bind with any other proteins in the brain tissue extract. This suggests that 4OTFB might not have any adverse effects on brain function.

Formula: C₈H₅F₃O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 206.12 g/mol

Ref: 3D-FH67495