CAS 22027-53-8
:Methyl 3-(4-chlorophenyl)-3-oxopropanoate
Description:
Methyl 3-(4-chlorophenyl)-3-oxopropanoate, with the CAS number 22027-53-8, is an organic compound characterized by its ester functional group and a ketone moiety. It features a methyl ester derived from a propanoic acid structure, where the propanoic acid is substituted with a 4-chlorophenyl group at the alpha position. This substitution imparts unique chemical properties, including increased lipophilicity and potential biological activity. The presence of the chlorophenyl group can enhance the compound's reactivity and influence its interactions in various chemical environments. Methyl 3-(4-chlorophenyl)-3-oxopropanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, making it useful in organic synthesis and pharmaceutical applications. The compound may exhibit various biological activities, which can be explored in medicinal chemistry contexts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C10H9ClO3
InChI:InChI=1/C10H9ClO3/c1-14-10(13)6-9(12)7-2-4-8(11)5-3-7/h2-5H,6H2,1H3
SMILES:COC(=O)CC(=O)c1ccc(cc1)Cl
Synonyms:- Benzenepropanoic acid, 4-chloro-beta-oxo-, methyl ester
- Methyl 4-chlorobenzoylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl (4-chlorobenzoyl)acetate
CAS:Formula:C10H9ClO3Purity:90%Color and Shape:SolidMolecular weight:212.6297Methyl 3-(4-chlorophenyl)-3-oxopropanoate
CAS:Methyl 3-(4-chlorophenyl)-3-oxopropanoateFormula:C10H9ClO3Purity:98%Color and Shape: clear. colourless oilMolecular weight:212.63g/mol3-(4-Chloro-phenyl)-3-oxo-propionic acid methylester
CAS:Formula:C10H9ClO3Purity:90%Color and Shape:Solid, ClearMolecular weight:212.63Methyl 3-(4_Chlorophenyl)-3-oxopropanoate
CAS:Controlled Product<p>Applications Methyl 3-(4-chlorophenyl)-3-oxopropanoate (cas# 22027-53-8) is a useful research chemical.<br></p>Formula:C10H9O3ClColor and Shape:NeatMolecular weight:212.62Methyl (4-chlorobenzoyl)acetate
CAS:<p>Methyl (4-chlorobenzoyl)acetate is a nonlinear optical material with hyperpolarizability. It has a fingerprint spectrum that can be used as an identification tool and it has been shown to have diffraction properties. This compound crystallizes in the orthorhombic crystal structure and its optical properties are determined by its interconnected molecular lattice. Methyl (4-chlorobenzoyl)acetate is used in the preparation of other compounds, such as methoxymethane, which can be used to synthesize pharmaceuticals such as acetaminophen.</p>Formula:C10H9ClO3Purity:Min. 95%Molecular weight:212.63 g/mol




