CymitQuimica logo

CAS 220312-34-5

:

tert-butyl 2-(2-hydroxyethyl)pyrrolidine-1-carboxylate

Description:
Tert-butyl 2-(2-hydroxyethyl)pyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a tert-butyl group, which contributes to its hydrophobic characteristics, and a hydroxyethyl substituent that introduces a polar functional group, enhancing its solubility in polar solvents. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often found in biologically active compounds. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, tert-butyl 2-(2-hydroxyethyl)pyrrolidine-1-carboxylate is a versatile compound with potential utility in various chemical and pharmaceutical applications.
Formula:C11H21NO3
InChI:InChI=1/C11H21NO3/c1-11(2,3)15-10(14)12-7-4-5-9(12)6-8-13/h9,13H,4-8H2,1-3H3
InChI key:MXPOLUPSEVGAAS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC1CCO
Synonyms:
  • 1-Pyrrolidinecarboxylic acid, 2-(2-hydroxyethyl)-, 1,1-dimethylethyl ester
  • 1-N-Boc-2-(2-hydroxy-ethyl)-pyrrolidine
  • tert-Butyl 2-(2-hydroxyethyl)pyrrolidine-1-carboxylate
  • rac 1-Boc-2-(2-hydroxyethyl)-pyrrolidine, 98%
  • 1-Boc-2-(2-hydroxyethyl)-pyrrolidine
  • rac 1-Boc-2-(2-hydroxyethyl)-pyrro
Found 5 products.