CAS 22034-13-5

4-bromo-2,1,3-benzothiadiazole

Description:

4-Bromo-2,1,3-benzothiadiazole is a heterocyclic compound characterized by its fused benzene and thiadiazole rings, with a bromine substituent at the 4-position of the benzothiadiazole moiety. This compound typically exhibits a yellow to orange color and is known for its stability under ambient conditions. It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane, but has limited solubility in water. The presence of the bromine atom enhances its electronic properties, making it useful in various applications, including organic electronics, photonic devices, and as a building block in the synthesis of more complex organic molecules. Additionally, 4-bromo-2,1,3-benzothiadiazole can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Its unique structure and properties make it a subject of interest in materials science and medicinal chemistry research.

Formula: C₆H₃BrN₂S

InChI: InChI=1/C6H3BrN2S/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H

SMILES: c1cc(c2c(c1)nsn2)Br

4-Bromo-2,1,3-benzothiadiazole

CAS: 22034-13-5

Formula: C₆H₃BrN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.07

Ref: 10-F067499

4-Bromobenzo[c][1,2,5]thiadiazole

CAS: 22034-13-5

Formula: C₆H₃BrN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.0704

Ref: IN-DA0070ZA

4-Bromobenzo[c][1,2,5]thiadiazole

CAS: 22034-13-5

Formula: C₆H₃BrN₂S

Purity: >98.0%(GC)(qNMR)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 215.07

Ref: 3B-B7011

4-Bromo-2,1,3-benzothiadiazole

CAS: 22034-13-5

4-Bromo-2,1,3-benzothiadiazole

Formula: C₆H₃BrN₂S

Purity: 85%

Color and Shape: faint brown/beige crystals

Molecular weight: 215.07g/mol

Ref: 54-OR2989