CAS 22034-63-5
:(17beta)-3-propoxyestra-1,3,5(10)-trien-17-ol
Description:
(17beta)-3-Propoxyestra-1,3,5(10)-trien-17-ol, with the CAS number 22034-63-5, is a synthetic steroid compound that belongs to the class of estrogens. This compound features a propoxy group at the 3-position and a hydroxyl group at the 17-position of the estrane backbone, which is characteristic of many steroid hormones. Its structure allows it to interact with estrogen receptors, influencing various biological processes such as reproductive functions and secondary sexual characteristics. The presence of the propoxy group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. As a synthetic derivative, it may exhibit distinct pharmacological properties compared to natural estrogens, including variations in potency, selectivity, and metabolic stability. This compound is of interest in medicinal chemistry and pharmacology, particularly in the development of hormone therapies and contraceptives. However, its specific biological effects, therapeutic applications, and safety profile would require further investigation through clinical studies and research.
Formula:C21H30O2
InChI:InChI=1/C21H30O2/c1-3-12-23-15-5-7-16-14(13-15)4-6-18-17(16)10-11-21(2)19(18)8-9-20(21)22/h5,7,13,17-20,22H,3-4,6,8-12H2,1-2H3/t17-,18-,19+,20+,21+/m1/s1
Synonyms:- 3-Propoxyestra-1,3,5(10)-trien-17beta-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Estradiol 3-Propyl Ether
CAS:Formula:C21H30O2Color and Shape:White To Off-White SolidMolecular weight:314.47Estradiol 3-Propyl Ether
CAS:Controlled ProductFormula:C21H30O2Color and Shape:NeatMolecular weight:314.46Estradiol-d3 3-Propyl Ether
CAS:Controlled ProductFormula:C20D3H25O2Color and Shape:NeatMolecular weight:303.454


