CAS 2204-98-0

(4-Chlorophenyl)cyclopentylmethanone

Description:

(4-Chlorophenyl)cyclopentylmethanone, identified by its CAS number 2204-98-0, is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a chlorophenyl moiety. This compound typically exhibits a white to off-white crystalline appearance. It is known for its moderate solubility in organic solvents, while being less soluble in water, which is common for many organic ketones. The presence of the chlorophenyl group can impart specific electronic properties, influencing its reactivity and potential applications in organic synthesis and medicinal chemistry. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. Additionally, the compound's structural features suggest potential uses in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and safety profile. Overall, (4-Chlorophenyl)cyclopentylmethanone is a compound of interest in the field of organic chemistry due to its distinctive characteristics and potential utility.

Formula: C₁₂H₁₃ClO

InChI: InChI=1S/C12H13ClO/c13-11-7-5-10(6-8-11)12(14)9-3-1-2-4-9/h5-9H,1-4H2

InChI key: InChIKey=OAUNRWNNNLUFEF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(Cl)C=C1)C2CCCC2

Synonyms:

• (4-Chlorophenyl)cyclopentylmethanone
• Ketone, p-chlorophenyl cyclopentyl
• Methanone, (4-Chlorophenyl)Cyclopentyl-
• p-Chlorophenyl cyclopentyl ketone
• (4-Chlorophenyl)(cyclopentyl)methanone

4-Chlorophenyl cyclopentyl ketone

CAS: 2204-98-0

Formula: C₁₂H₁₃ClO

Purity: 97.0%

Molecular weight: 208.69

Ref: 10-F204122

p-Chlorophenyl Cyclopentyl Ketone

Controlled Product

CAS: 2204-98-0

Applications p-Chlorophenyl Cyclopentyl Ketone is a derivative of Ketamine (K165300), which is an anesthetic (intravenous).
References Stevens, C. L.,et al.: J. Org. Chem., 31, 2593 (1966);

Formula: C₁₂H₁₃ClO

Color and Shape: Neat

Molecular weight: 208.68

Ref: TR-C377835

(4-Chlorophenyl)(cyclopentyl)methanone

CAS: 2204-98-0

Versatile small molecule scaffold

Formula: C₁₂H₁₃ClO

Purity: Min. 95%

Molecular weight: 208.68 g/mol

Ref: 3D-CAA20498