CAS 220430-82-0
:2',4-Dihydroxy-3-methoxychalcone
Description:
2',4-Dihydroxy-3-methoxychalcone is a flavonoid compound characterized by its chalcone structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This compound features two hydroxyl groups at the 2' and 4' positions and a methoxy group at the 3 position of the A-ring, contributing to its unique chemical properties and potential biological activities. It is typically a yellow to orange solid, soluble in organic solvents, and exhibits moderate stability under standard conditions. The presence of hydroxyl and methoxy groups enhances its antioxidant properties and may influence its reactivity and interaction with biological systems. 2',4-Dihydroxy-3-methoxychalcone has garnered interest in pharmacological research due to its potential anti-inflammatory, antimicrobial, and anticancer activities. Its structure allows for various modifications, making it a valuable compound in the development of new therapeutic agents. As with many flavonoids, its biological effects are often attributed to its ability to modulate signaling pathways and interact with cellular components.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-20-16-10-11(7-9-15(16)19)6-8-14(18)12-4-2-3-5-13(12)17/h2-10,17,19H,1H3/b8-6+
InChI key:NGQQEEYHKPKSER-SOFGYWHQSA-N
SMILES:COC1=C(C=CC(=C1)/C=C/C(=O)C2=CC=CC=C2O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one
CAS:(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-oneFormula:C16H14O4Purity:≥95%Molecular weight:270.28(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one
CAS:Formula:C16H14O4Purity:95%Molecular weight:270.28002',4-Dihydroxy-3-methoxychalcone
CAS:2',4-Dihydroxy-3-methoxychalcone is a chalcone that has been shown to have reactive properties. The compound was found to be cytotoxic to cancer cells in the presence of neutrophils, and it has been shown to inhibit the growth of t47d cells in culture. There is also evidence that 2',4-Dihydroxy-3-methoxychalcone may help regulate the microflora in the gut, which may help prevent obesity and diabetes. In epidemiological studies, 2',4-Dihydroxy-3-methoxychalcone was found to be protective against cancer, but more research is required.
Formula:C16H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:270.28 g/mol



