CAS 22049-24-7

9-methyl-6,9-diazaspiro[4.5]decane-7,10-dione

Description:

9-Methyl-6,9-diazaspiro[4.5]decane-7,10-dione, with the CAS number 22049-24-7, is a bicyclic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single atom. This compound features two nitrogen atoms incorporated into its structure, contributing to its diaza designation. The presence of the methyl group at the 9-position and the diketone functionality at the 7 and 10 positions are significant for its chemical reactivity and potential applications. The spirocyclic nature of the molecule often imparts interesting conformational properties, which can influence its biological activity and interactions with other molecules. Such compounds may exhibit a range of pharmacological effects, making them of interest in medicinal chemistry. Additionally, the presence of functional groups like carbonyls can enhance reactivity, allowing for further chemical modifications. Overall, 9-methyl-6,9-diazaspiro[4.5]decane-7,10-dione represents a class of compounds that can be explored for various applications in organic synthesis and drug development.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1/C9H14N2O2/c1-11-6-7(12)10-9(8(11)13)4-2-3-5-9/h2-6H2,1H3,(H,10,12)

SMILES: CN1CC(=NC2(CCCC2)C1=O)O

9-methyl-6,9-diazaspiro[4.5]decane-7,10-dione

CAS: 22049-24-7

Formula: C₉H₁₄N₂O₂

Purity: 95.0%

Molecular weight: 182.223

Ref: 10-F495667