CAS 220497-61-0
:(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentaneacetic acid
Description:
(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentaneacetic acid, with CAS number 220497-61-0, is a synthetic organic compound primarily used in peptide synthesis and as a protecting group in organic chemistry. This compound features a cyclopentaneacetic acid backbone, which contributes to its unique structural properties. The presence of the fluorenylmethoxycarbonyl (Fmoc) group serves as a protective moiety for the amino group, facilitating selective reactions during peptide assembly. The stereochemistry indicated by (αS) suggests a specific spatial arrangement of atoms, which can influence the compound's reactivity and interaction with biological systems. This compound is typically characterized by its solid state, stability under standard laboratory conditions, and solubility in organic solvents. Its applications extend to pharmaceutical research, particularly in the development of peptide-based drugs, where the ability to manipulate amino acid sequences is crucial. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, showcasing the importance of protecting groups in the synthesis of complex molecules.
Formula:C22H23NO4
InChI:InChI=1S/C22H23NO4/c24-21(25)20(14-7-1-2-8-14)23-22(26)27-13-19-17-11-5-3-9-15(17)16-10-4-6-12-18(16)19/h3-6,9-12,14,19-20H,1-2,7-8,13H2,(H,23,26)(H,24,25)/t20-/m0/s1
InChI key:InChIKey=JGWHUIQSEKGLAQ-FQEVSTJZSA-N
SMILES:C(OC(N[C@H](C(O)=O)[C@H]1CCCC1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- (2S)-2-Cyclopentyl-2-([[(9H-fluoren-9-yl)methoxy]carbonyl]amino)acetic acid
- (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopentylacetic acid
- (S)-2-Cyclopentyl-2-(Fmoc-Amino)-Acetic Acid
- (S)-N-Fmoc-2-Amino-2-Cyclopentyl Acetic Acid
- (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentaneacetic acid
- Cyclopentaneacetic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αS)-
- Fmoc-Cpg-Oh
- Fmoc-Cyclopentyl-Gly-Oh
- Fmoc-Cyclopentyl-Glycine
- Fmoc-L-Cyclopentylglycine
- N-Alpha-(9-Fluorenylmethoxycarbonyl)-L-Cyclopentylglycine
- N-Alpha-(9-Fluorenylmethyloxycarbonyl)-L-Beta-Cyclopentylglycine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fmoc-Cpg-OH
CAS:Bachem ID: 4040958.
Formula:C22H23NO4Purity:99.8%Color and Shape:White PowderMolecular weight:365.43Fmoc-cyclopentyl-Gly-OH
CAS:Formula:C22H23NO4Purity:98%Color and Shape:SolidMolecular weight:365.4223(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopentylacetic acid
CAS:Formula:C22H23NO4Purity:95%Color and Shape:Solid, White powderMolecular weight:365.429Fmoc-L-cyclopentylglycine
CAS:Fmoc-L-cyclopentylglycine is an asymmetric synthesis catalyst that allows the construction of a cyclopentyl ring system. It is synthesized by alkylating a glycine with cyclopentyl bromide, catalytic hydrogenolysis, and high yield. The stereoselectivity of this reaction can be controlled to produce either a syn or anti product. Fmoc-L-cyclopentylglycine has been used in efficient diastereoselective hydrogenolysis of benzyl ethers. The Fmoc group is removed by strong acid (e.g., fmoc-osu) in order to avoid racemization.
Formula:C22H23NO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:365.42 g/mol




