CAS 220497-79-0

(R)-N-FMOC-2-Bromophenylalanine

Description:

(R)-N-FMOC-2-Bromophenylalanine is a derivative of the amino acid phenylalanine, characterized by the presence of a 2-bromo substituent on the aromatic ring and a fluorenylmethyloxycarbonyl (FMOC) protective group on the amino group. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), due to the FMOC group, which allows for selective deprotection under mild conditions. The bromine atom introduces a halogen that can participate in further chemical reactions, making it a versatile building block in organic synthesis. The (R) configuration indicates the specific stereochemistry of the amino acid, which is crucial for maintaining the biological activity and structural integrity of peptides. Additionally, this compound is often utilized in the development of pharmaceuticals and biologically active compounds, owing to its ability to form stable peptide bonds and its compatibility with various coupling reagents. Overall, (R)-N-FMOC-2-Bromophenylalanine serves as an important tool in the field of medicinal chemistry and peptide research.

Formula: C₂₄H₂₀BrNO₄

InChI: InChI=1/C24H20BrNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1

SMILES: c1ccc(c(c1)C[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)Br

Synonyms:

• Fmoc-D-2-Bromophenylalanine
• Fmoc-2-Bromo-D-phenylalanine

D-Phenylalanine,2-bromo-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-

CAS: 220497-79-0

Formula: C₂₄H₂₀BrNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 466.3239

Ref: IN-DA00I4BH

2-Bromo-D-phenylalanine, N-FMOC protected

CAS: 220497-79-0

2-Bromo-D-phenylalanine, N-FMOC protected

Purity: 98%

Molecular weight: 466.3239g/mol

Ref: 54-OR14555

(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-bromophenyl)propanoic acid

CAS: 220497-79-0

Purity: 98%

Molecular weight: 466.3309937

Ref: 10-F692581