CAS 22051-15-6
:1H-indol-3-yl(4-methoxyphenyl)methanone
Description:
1H-Indol-3-yl(4-methoxyphenyl)methanone, also known by its CAS number 22051-15-6, is an organic compound characterized by its indole and methoxyphenyl functional groups. This compound features a core indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of the methoxy group (-OCH3) on the para position of the phenyl ring enhances its electron-donating properties, potentially influencing its reactivity and solubility. The methanone functional group (ketone) contributes to the compound's overall polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and solvents used. Overall, 1H-indol-3-yl(4-methoxyphenyl)methanone is a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C16H13NO2
InChI:InChI=1/C16H13NO2/c1-19-12-8-6-11(7-9-12)16(18)14-10-17-15-5-3-2-4-13(14)15/h2-10,17H,1H3
InChI key:InChIKey=KLNHIIYKFBCQQB-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=2C(NC1)=CC=CC2)C3=CC=C(OC)C=C3
Synonyms:- 3-(p-Methoxybenzoyl)indole
- Indol-3-yl p-methoxyphenyl ketone
- Ketone, indol-3-yl p-methoxyphenyl
- Methanone, 1H-indol-3-yl(4-methoxyphenyl)-
- 1H-Indol-3-yl(4-methoxyphenyl)methanone
- 3-(4-Anisoyl)-indole
- 3-ANISOYL-INDOLE
- 1h-indol-3-yl(4-methoxyphenyl)-methanon
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(p-Methoxybenzoyl)indole
CAS:Controlled ProductApplications 3-(p-Methoxybenzoyl)indole is an intermediate in the synthesis of JWH derivatives.
References Guchhait, S.K., et al.: J. Org. Chem., 76, 4753 (2011)Formula:C16H13NO2Color and Shape:NeatMolecular weight:251.28
