CAS 22052-03-5
:2-amino-8-chloro-3,7-dihydro-6H-purin-6-one
Description:
2-amino-8-chloro-3,7-dihydro-6H-purin-6-one, also known by its CAS number 22052-03-5, is a purine derivative characterized by its structural features that include an amino group at the 2-position and a chloro substituent at the 8-position of the purine ring. This compound exhibits properties typical of purines, such as being a heterocyclic aromatic compound, which contributes to its biological activity. It is often studied for its potential applications in medicinal chemistry, particularly in the development of antiviral and anticancer agents due to its ability to interact with nucleic acids. The presence of the amino and chloro groups can influence its solubility, reactivity, and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as UV-Vis and NMR spectroscopy, which can be utilized for its identification and analysis in research settings. Overall, 2-amino-8-chloro-3,7-dihydro-6H-purin-6-one is a significant compound in the field of biochemistry and pharmacology.
Formula:C5H4ClN5O
InChI:InChI=1/C5H4ClN5O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h(H4,7,8,9,10,11,12)
SMILES:c12c([nH]c(Cl)n2)[nH]c(=N)nc1O
Synonyms:- 8-Chloroguanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8-Chloroguanine
CAS:8-Chloroguanine is a carcinogen that has been shown to cause cancer in laboratory animals. It is a reactive compound with a hydroxyl group and a hydrogen bond that can react with DNA, leading to the formation of 8-chloroadenine (8-CAD) and 8-chloroguanine (8-CG). These compounds are then converted into hypochlorous acid, which has been shown to be an inflammatory agent. The analytical method for quantifying 8-chloroguanine can be done by electrochemical impedance spectroscopy. This method has been used in model studies of inflammatory diseases.Formula:C5H4ClN5OPurity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:185.57 g/mol


