CAS 22059-64-9

2-Acetyl-3-methylquinoxaline

Description:

2-Acetyl-3-methylquinoxaline is an organic compound belonging to the quinoxaline family, characterized by its bicyclic structure containing two nitrogen atoms in the aromatic ring. It typically appears as a yellow to brown solid and has a molecular formula that reflects its acetyl and methyl substituents. This compound is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. Its melting point and solubility can vary, but it is generally soluble in organic solvents. The presence of the acetyl group contributes to its reactivity, allowing for various chemical transformations. Additionally, 2-acetyl-3-methylquinoxaline can participate in reactions typical of quinoxalines, such as electrophilic substitutions and condensation reactions. Its unique structure and functional groups make it a valuable compound for synthetic organic chemistry and medicinal chemistry applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c1-7-11(8(2)14)13-10-6-4-3-5-9(10)12-7/h3-6H,1-2H3

InChI key: InChIKey=XXKIXPWTFVBBJF-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=NC2=C(N=C1C)C=CC=C2

Synonyms:

• 1-(3-Methyl-2-quinoxalinyl)ethanone
• 3-Acetyl-2-methylquinoxaline
• Ethanone, 1-(3-methyl-2-quinoxalinyl)-
• Ketone, methyl 3-methyl-2-quinoxalinyl
• 2-Acetyl-3-methylquinoxaline

Mequindox Impurity 1

CAS: 22059-64-9

Formula: C₁₁H₁₀N₂O

Color and Shape: Yellow Solid

Molecular weight: 186.21

Ref: 4Z-M-211002

1-(3-Methyl-quinoxalin-2-yl)ethanone

CAS: 22059-64-9

1-(3-Methyl-quinoxalin-2-yl)ethanone

Purity: 95%

Molecular weight: 186.21g/mol

Ref: 54-OR346581

3-Acetyl-2-methylquinoxaline

CAS: 22059-64-9

Applications 3-Acetyl-2-methylquinoxaline is an intermediate in the synthesis of Desoxyquinocetone which is a metabolite of the veterinay drug Quinocetone.
References Li, Y. et al.: J. AOAC Int., 91, 1494 (2008); Liu, Z.-Y. et al.: Anal. Bioanal. Chem., 396, 1259 (1271);

Formula: C₁₁H₁₀N₂O

Color and Shape: Neat

Molecular weight: 186.21

Ref: TR-A186875

3-Acetyl-2-methylquinoxaline-13C6

Controlled Product

CAS: 22059-64-9

Formula: C₆C₅H₁₀N₂O

Color and Shape: Neat

Molecular weight: 192.166

Ref: TR-A186877

Mequindox Impurity 1

CAS: 22059-64-9

Formula: C₁₁H₁₀N₂O

Molecular weight: 186.21

Ref: ST-EA-CP-M217007