CAS 220616-39-7
:3-Cyanomethylphenylboronic acid
Description:
3-Cyanomethylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a cyanomethyl substituent on a phenyl ring. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity and solubility in polar solvents. Additionally, 3-cyanomethylphenylboronic acid can participate in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Its structural features contribute to its potential as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound is generally handled with care due to the potential toxicity associated with boron-containing compounds and the reactivity of the cyano group. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C8H8BNO2
InChI:InChI=1/C8H8BNO2/c10-5-4-7-2-1-3-8(6-7)9(11)12/h1-3,6,11-12H,4H2
SMILES:c1cc(CC#N)cc(c1)B(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Cyanomethyl)benzeneboronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H8BNO2Purity:96%Molecular weight:160.97(3-(Cyanomethyl)phenyl)boronic acid
CAS:Formula:C8H8BNO2Purity:97%Color and Shape:SolidMolecular weight:160.96563-(Cyanomethyl)benzeneboronic acid
CAS:3-(Cyanomethyl)benzeneboronic acidFormula:C8H8BNO2Purity:97%Color and Shape: tan solidMolecular weight:160.97g/mol[3-(cyanomethyl)phenyl]boronic acid
CAS:Formula:C8H8BNO2Purity:97%Color and Shape:White powderMolecular weight:160.97



