CAS 22062-53-9
:5-Fluoro-2-methylbenzaldehyde
Description:
5-Fluoro-2-methylbenzaldehyde, with the CAS number 22062-53-9, is an aromatic aldehyde characterized by the presence of a fluorine atom and a methyl group on a benzene ring. This compound features a benzaldehyde functional group, which is known for its reactivity and ability to participate in various chemical reactions, such as nucleophilic additions. The fluorine substituent can influence the electronic properties of the molecule, potentially enhancing its reactivity and affecting its physical properties, such as boiling and melting points. Typically, aromatic aldehydes exhibit distinct odors, and 5-fluoro-2-methylbenzaldehyde may possess a unique scent due to its structural characteristics. In terms of solubility, it is generally soluble in organic solvents, while its solubility in water may be limited. This compound is of interest in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H7FO
InChI:InChI=1/C8H7FO/c1-6-2-3-8(9)4-7(6)5-10/h2-5H,1H3
SMILES:Cc1ccc(cc1C=O)F
Synonyms:- Benzaldehyde, 5-fluoro-2-methyl-
- Vhr Cf F1
- 5-FLUORO-2-METHYLBENZALDEHYDE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-FLUORO-2-METHYLBENZALDEHYDE
CAS:Formula:C8H7FOPurity:90%Color and Shape:LiquidMolecular weight:138.13905-Fluoro-2-methylbenzaldehyde
CAS:5-Fluoro-2-methylbenzaldehydeFormula:C8H7FOPurity:95%Color and Shape: clear. almost colourless to faint yellow liquidMolecular weight:138.14g/mol5-Fluoro-2-methylbenzaldehyde
CAS:Formula:C8H7FOPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:138.145-Fluoro-2-methylbenzaldehyde
CAS:5-Fluoro-2-methylbenzaldehyde is a fine chemical that is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic molecules. It is also useful in the preparation of synthetic resins, dyes, and flavors. 5-Fluoro-2-methylbenzaldehyde has been shown to be a versatile building block with many potential applications. This molecule can be used as a reaction component or as a speciality chemical to produce high quality reagents.
Formula:C8H7FOPurity:90%Color and Shape:Clear LiquidMolecular weight:138.14 g/mol5-Fluoro-2-methylbenzaldehyde
CAS:Formula:C8H7FOPurity:95%Color and Shape:Liquid, ClearMolecular weight:138.141




