CAS 22064-40-0
:(2-amino-2-oxoethoxy)acetic acid
Description:
(2-amino-2-oxoethoxy)acetic acid, with the CAS number 22064-40-0, is an organic compound characterized by the presence of both amino and carboxylic acid functional groups. This compound features an ethoxy group, which contributes to its solubility in polar solvents. The amino group imparts basic properties, while the carboxylic acid group provides acidic characteristics, making it a zwitterionic molecule under certain pH conditions. Its structure suggests potential applications in pharmaceuticals and biochemistry, particularly as a building block for peptide synthesis or as a ligand in coordination chemistry. The compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the presence of other functional groups or environmental factors. Additionally, due to its dual functional nature, it may participate in various chemical reactions, including esterification and amidation. Overall, (2-amino-2-oxoethoxy)acetic acid is a versatile compound with potential utility in various chemical and biological applications.
Formula:C4H7NO4
InChI:InChI=1/C4H7NO4/c5-3(6)1-9-2-4(7)8/h1-2H2,(H2,5,6)(H,7,8)
SMILES:C(C(=N)O)OCC(=O)O
Synonyms:- Acetic Acid, 2-(2-Amino-2-Oxoethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Amino-2-oxoethoxy)acetic acid
CAS:2-(2-Amino-2-oxoethoxy)acetic acidPurity:98%Molecular weight:133.10g/mol(2-Amino-2-oxoethoxy)acetic acid
CAS:<p>2-Amino-2-oxoethoxy)acetic acid is a product that can be used as a transport agent in the process of extracting glycosides. It has been shown to have strong adsorption properties and is able to extract glycosides from plant material. 2-Amino-2-oxoethoxy)acetic acid has a high affinity for calcium, which is an important component in the adsorption mechanism.</p>Formula:C4H7NO4Purity:Min. 95%Molecular weight:133.1 g/mol
