CAS 22064-42-2
:2-[2-Oxo-2-(phenylamino)ethoxy]acetic acid
Description:
2-[2-Oxo-2-(phenylamino)ethoxy]acetic acid, with the CAS number 22064-42-2, is an organic compound characterized by its functional groups, which include an oxo group, an amino group, and a carboxylic acid. This compound features a phenylamino moiety, indicating the presence of a phenyl group attached to an amino group, which contributes to its potential biological activity. The ethoxy group suggests that it has ether characteristics, providing solubility in organic solvents. The presence of the carboxylic acid group indicates acidic properties, which can influence its reactivity and interactions in various chemical environments. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals due to its structural features. Its molecular structure allows for hydrogen bonding, which can affect its solubility and interaction with biological systems. Overall, 2-[2-Oxo-2-(phenylamino)ethoxy]acetic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H11NO4
InChI:InChI=1S/C10H11NO4/c12-9(6-15-7-10(13)14)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14)
InChI key:InChIKey=LXDURDIZZUUDNF-UHFFFAOYSA-N
SMILES:N(C(COCC(O)=O)=O)C1=CC=CC=C1
Synonyms:- 2-[2-Oxo-2-(phenylamino)ethoxy]acetic acid
- Acetic acid, [(phenylcarbamoyl)methoxy]-
- Acetic acid, [2-oxo-2-(phenylamino)ethoxy]-
- Acetic acid,[2-oxo-2-(phenylamino)ethoxy]- (9CI)
- Aceticacid, [(phenylcarbamoyl)methoxy]- (8CI)
- Diglycolanilic acid
- Acetic acid, 2-[2-oxo-2-(phenylamino)ethoxy]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery