CAS 220641-11-2

1-cyano-3-(4-cyanophenyl)-2-[(2R)-3,3-dimethylbutan-2-yl]guanidine

Description:

1-Cyano-3-(4-cyanophenyl)-2-[(2R)-3,3-dimethylbutan-2-yl]guanidine, with the CAS number 220641-11-2, is a synthetic organic compound characterized by its guanidine structure, which features a cyano group and a branched alkyl substituent. This compound typically exhibits properties associated with guanidines, such as being a strong base and potentially acting as a ligand in coordination chemistry. The presence of multiple cyano groups suggests it may have applications in materials science or as an intermediate in organic synthesis. Its branched alkyl chain may influence its solubility and reactivity, making it suitable for specific chemical reactions or formulations. Additionally, the compound's structural complexity may impart unique biological activities, warranting investigation in pharmaceutical contexts. Overall, 1-cyano-3-(4-cyanophenyl)-2-[(2R)-3,3-dimethylbutan-2-yl]guanidine represents a versatile compound with potential applications in various fields, including medicinal chemistry and materials development.

Formula: C₁₅H₁₉N₅

InChI: InChI=1/C15H19N5/c1-11(15(2,3)4)19-14(18-10-17)20-13-7-5-12(9-16)6-8-13/h5-8,11H,1-4H3,(H2,18,19,20)/t11-/m1/s1

SMILES: C[C@H](C(C)(C)C)NC(=NC#N)Nc1ccc(cc1)C#N

Naminidil

CAS: 220641-11-2

Naminidil is an opener of cyanoguanidine KATP.

Formula: C₁₅H₁₉N₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 269.34

Ref: TM-T16267

Naminidil

CAS: 220641-11-2

Naminidil is a pro-drug, which is synthetically derived through the modification of specific active compounds. This derivation involves chemical synthesis techniques aimed at enhancing bioavailability and selective activation in biological systems. The mode of action of Naminidil involves enzymatic conversion to its active form within the target tissues, allowing for localized therapeutic effects while minimizing systemic exposure. This targeted approach is designed to optimize the pharmacokinetic properties of the drug, enhancing its efficacy and safety profile.

Formula: C₁₅H₁₉N₅

Purity: Min. 95%

Molecular weight: 269.34 g/mol

Ref: 3D-VIA64111