CAS 220643-77-6

4-iodo-N-{2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl}-N-(pyridin-2-yl)benzamide hydrochloride (1:1)

Description:

4-Iodo-N-{2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl}-N-(pyridin-2-yl)benzamide hydrochloride is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with an iodine atom and a pyridine ring. This compound features a piperazine moiety, which is known for its role in pharmacological activity, particularly in the central nervous system. The presence of the methoxyphenyl group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including medicinal chemistry. The compound's unique combination of functional groups suggests potential activity as a pharmaceutical agent, possibly in the treatment of neurological disorders or as an antipsychotic. However, detailed studies on its pharmacodynamics, pharmacokinetics, and safety profile would be necessary to fully understand its therapeutic potential and applications.

Formula: C₂₅H₂₈ClIN₄O₂

InChI: InChI=1/C25H27IN4O2.ClH/c1-32-23-7-3-2-6-22(23)29-17-14-28(15-18-29)16-19-30(24-8-4-5-13-27-24)25(31)20-9-11-21(26)12-10-20;/h2-13H,14-19H2,1H3;1H

InChI key: PBPBIDMIRMWUCI-UHFFFAOYSA-N

SMILES: COc1ccccc1N1CCN(CC1)CCN(c1ccccn1)C(=O)c1ccc(cc1)I.Cl

p-MPPI hydrochloride

CAS: 220643-77-6

p-MPPI hydrochloride is a selective antagonist of 5-HT1A receptor, and has antidepressant and anxiolytic-like effects.

Formula: C₂₅H₂₈ClIN₄O₂

Purity: 99.95%

Color and Shape: White Solid

Molecular weight: 578.873

Ref: TM-T16421

p-MPPI hydrochloride

CAS: 220643-77-6

p-MPPI hydrochloride

Formula: C₂₅H₂₈ClIN₄O₂

Purity: ≥98%

Molecular weight: 578.87

Ref: 54-BUP06914

p-MPPI (hydrochloride)

CAS: 220643-77-6

Formula: C₂₅H₂₈ClIN₄O₂

Molecular weight: 578.8729

Ref: IN-DA007PYC