CymitQuimica logo

CAS 22068-57-1

:

4-(2-methyl-1,3-dithiolan-2-yl)phenol

Description:
4-(2-Methyl-1,3-dithiolan-2-yl)phenol, identified by its CAS number 22068-57-1, is an organic compound characterized by the presence of a phenolic group and a dithiolan moiety. The structure features a phenol ring substituted with a dithiolan group, which contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of functional properties due to the presence of sulfur atoms in the dithiolan ring, which can influence its reactivity and interactions with other molecules. The dithiolan structure can provide potential applications in various fields, including materials science and organic synthesis, due to its ability to form complexes with metals and participate in redox reactions. Additionally, the presence of the hydroxyl group in the phenol part of the molecule enhances its solubility in polar solvents and may impart antioxidant properties. Overall, 4-(2-methyl-1,3-dithiolan-2-yl)phenol is a compound of interest for further research and application in chemical and pharmaceutical industries.
Formula:C10H12OS2
InChI:InChI=1/C10H12OS2/c1-10(12-6-7-13-10)8-2-4-9(11)5-3-8/h2-5,11H,6-7H2,1H3
SMILES:CC1(c2ccc(cc2)O)SCCS1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.