CAS 22071-22-3: 3-Benzoylbenzeneacetic acid
Description:3-Benzoylbenzeneacetic acid, also known by its CAS number 22071-22-3, is an organic compound characterized by its aromatic structure, which includes a benzoyl group and an acetic acid moiety. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of multiple aromatic rings. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its structure suggests potential applications in pharmaceuticals and organic synthesis, particularly as an intermediate in the production of more complex molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, specific reactivity and stability characteristics would depend on the conditions under which it is handled, including temperature, pH, and the presence of other reagents. As with many organic compounds, proper safety measures should be observed when working with this substance.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-14(17)10-11-5-4-8-13(9-11)15(18)12-6-2-1-3-7-12/h1-9H,10H2,(H,16,17)
InChI key:InChIKey=ALDSXDRDRWDASQ-UHFFFAOYSA-N
SMILES:O=C(O)CC=1C=CC=C(C1)C(=O)C=2C=CC=CC2
- Synonyms:
- (3-Benzoylphenyl)acetic acid
- 2-(3-Benzoylphenyl)acetic acid
- 3-Benzoylbenzeneacetic acid
- 3-Benzoylphenylacetic acid
- Acetic acid, (m-benzoylphenyl)-
- Benzeneacetic acid, 3-benzoyl-
- Ru 4462
- m-Benzoylphenylacetic acid
