CAS 22071-39-2

2-amino-5-phenoxybenzoic acid

Description:

2-Amino-5-phenoxybenzoic acid, with the CAS number 22071-39-2, is an organic compound characterized by its aromatic structure and functional groups. It features an amino group (-NH2) and a phenoxy group (-O-Ph) attached to a benzoic acid backbone, which contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid and amino groups. Its molecular structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-Amino-5-phenoxybenzoic acid may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, its derivatives can be synthesized for various applications, including as intermediates in organic synthesis or as potential therapeutic agents. Proper handling and storage are essential, as with many chemical substances, to ensure safety and stability.

Formula: C₁₃H₁₁NO₃

InChI: InChI=1/C13H11NO3/c14-12-7-6-10(8-11(12)13(15)16)17-9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16)

SMILES: c1ccc(cc1)Oc1ccc(c(c1)C(=O)O)N

Synonyms:

• 2-AMINO-5-PHENOXYBENZOIC ACID
• BENZOIC ACID, 2-AMINO-5-PHENOXY-

2-Amino-5-phenoxybenzoic acid

CAS: 22071-39-2

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₃

Purity: Min. 95%

Molecular weight: 229.23 g/mol

Ref: 3D-XAA07139