CAS 220805-22-1
:(Z)-N~5~-[amino(dimethylamino)methylidene]-L-ornithine dihydrochloride
Description:
(Z)-N~5~-[amino(dimethylamino)methylidene]-L-ornithine dihydrochloride is a chemical compound that belongs to the class of amino acids and their derivatives. It features a unique structure characterized by a substituted ornithine backbone, which includes an imine functional group due to the presence of the (Z)-configuration. This compound is typically encountered in research settings, particularly in studies related to biochemistry and pharmacology, due to its potential biological activity. The dihydrochloride form indicates that the compound is a salt, which enhances its solubility in aqueous solutions, making it suitable for various experimental applications. The presence of amino and dimethylamino groups suggests that it may interact with biological systems, potentially influencing metabolic pathways or serving as a precursor for other bioactive molecules. As with many amino acid derivatives, it may exhibit properties such as chirality, which can affect its interaction with enzymes and receptors in biological contexts. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory environments.
Formula:C8H20Cl2N4O2
InChI:InChI=1/C8H18N4O2.2ClH/c1-12(2)8(10)11-5-3-4-6(9)7(13)14;;/h6H,3-5,9H2,1-2H3,(H2,10,11)(H,13,14);2*1H/t6-;;/m0../s1
SMILES:CN(C)C(=N)NCCC[C@@H](C(=O)O)N.Cl.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
NG,NG-dimethyl-L-Arginine dihydrochloride
CAS:Formula:C8H18N4O2Purity:95%Color and Shape:SolidMolecular weight:202.2541NG,NG-dimethyl-L-Arginine dihydrochloride
CAS:NG,NG-dimethyl-L-Arginine dihydrochloridePurity:≥95%Molecular weight:275.18g/molNG,NG-Dimethylarginine dihydrochloride
CAS:Formula:C8H18N4O2·2HClPurity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:275.18NG,NG-dimethyl-L-Arginine dihydrochloride
CAS:NG,NG-dimethyl-L-Arginine dihydrochloride is an endogenous nitric oxide synthase inhibitor.Formula:C8H20Cl2N4O2Purity:97.83% - 99.18%Color and Shape:SolidMolecular weight:275.18NG,NG-Dimethylarginine Dihydrochloride
CAS:Controlled ProductApplications A potent inhibitor of NO synthase of adrenal glands, brain, and vascular endothelial cells.
References Vallence, P., et al.: Lancet, 339, 572 (1992),Formula:C8H18N4O2·2ClHColor and Shape:NeatMolecular weight:275.18




