CAS 22082-99-1

2-(4-Bromophenyl)naphthalene

Description:

2-(4-Bromophenyl)naphthalene, with the CAS number 22082-99-1, is an organic compound characterized by its structure, which consists of a naphthalene moiety substituted with a 4-bromophenyl group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of multiple benzene rings. It is generally insoluble in water but may dissolve in organic solvents such as ethanol, acetone, or dichloromethane. The presence of the bromine atom introduces both electronegative character and potential for further chemical reactivity, making it useful in various synthetic applications, including organic synthesis and materials science. Additionally, its unique structure may impart specific optical or electronic properties, which can be of interest in fields such as organic electronics or photonics. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.

Formula: C₁₆H₁₁Br

InChI: InChI=1/C16H11Br/c17-16-9-7-13(8-10-16)15-6-5-12-3-1-2-4-14(12)11-15/h1-11H

SMILES: c1ccc2cc(ccc2c1)c1ccc(cc1)Br

Synonyms:

• Naphthalene, 2-(4-bromophenyl)-

2-(4-Bromophenyl)naphthalene

CAS: 22082-99-1

Formula: C₁₆H₁₁Br

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 283.17

Ref: 3B-B4159

2-(4-Bromophenyl)naphthalene

CAS: 22082-99-1

Formula: C₁₆H₁₁Br

Purity: 97%

Color and Shape: Solid

Molecular weight: 283.1625

Ref: IN-DA00BDFX

2-(4-Bromophenyl)Naphthalene

CAS: 22082-99-1

2-(4-Bromophenyl)Naphthalene

Purity: 99%

Molecular weight: 283.17g/mol

Ref: 54-OR1009759

2-(4-Bromophenyl)naphthalene

CAS: 22082-99-1

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 283.1679992675781

Ref: 10-F036968