CAS 22084-89-5
:2-methylhydrocinnamic acid
Description:
2-Methylhydrocinnamic acid is an aromatic carboxylic acid characterized by its unique structure, which includes a methyl group attached to the hydrocinnamic acid backbone. This compound features a phenyl ring connected to a propanoic acid chain, with the methyl group positioned on the second carbon of the chain. It is typically a white to off-white crystalline solid and is known for its moderate solubility in organic solvents, while being less soluble in water. The compound exhibits typical acid properties, including the ability to donate protons in solution. Its melting point and boiling point can vary based on purity and environmental conditions. 2-Methylhydrocinnamic acid is of interest in various fields, including organic synthesis and fragrance chemistry, due to its potential applications in the formulation of perfumes and flavoring agents. Additionally, it may serve as an intermediate in the synthesis of other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-8-4-2-3-5-9(8)6-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)
SMILES:Cc1ccccc1CCC(=O)O
Synonyms:- 3-(2-Methylphenyl)propionic acid
- 3-(2-Methylphenyl)Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2-Methylphenyl)propionic acid, 96%
CAS:3-(2-Methylphenyl)propionic acid is a carboxylic acid building block. It participates in the synthesis of 2-methyl-3-phenylpropanol. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legac
Formula:C10H12O2Purity:96%Color and Shape:White, PowderMolecular weight:164.203-(2-Methylphenyl)propionic acid
CAS:Formula:C10H12O2Purity:96%Color and Shape:SolidMolecular weight:164.20113-(2-Methylphenyl)propionic acid
CAS:3-(2-Methylphenyl)propionic acidPurity:98%Molecular weight:164.20g/mol3-(2-Methylphenyl)propionic acid
CAS:Formula:C10H12O2Purity:96%Color and Shape:SolidMolecular weight:164.204



