CAS 22086-89-1

(2-phenyl-1,3-oxazol-4-yl)acetate

Description:

(2-phenyl-1,3-oxazol-4-yl)acetate, with the CAS number 22086-89-1, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocycle containing both nitrogen and oxygen atoms. This compound features a phenyl group attached to the oxazole ring, contributing to its aromatic properties and potential reactivity. The acetate functional group indicates the presence of an ester, which can influence the compound's solubility and reactivity in various chemical environments. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the oxazole moiety can also impart unique electronic properties, potentially affecting how the compound interacts with other molecules. In terms of physical properties, such compounds may be expected to be moderately soluble in organic solvents and exhibit stability under standard laboratory conditions. Overall, (2-phenyl-1,3-oxazol-4-yl)acetate represents a class of compounds that can be explored for various applications in organic synthesis and medicinal chemistry.

Formula: C₁₁H₈NO₃

InChI: InChI=1/C11H9NO3/c13-10(14)6-9-7-15-11(12-9)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,14)/p-1

SMILES: c1ccc(cc1)c1nc(CC(=O)[O-])co1

2-(2-Phenyl-1,3-oxazol-4-yl)acetic acid

CAS: 22086-89-1

Versatile small molecule scaffold

Formula: C₁₁H₉NO₃

Purity: Min. 95%

Molecular weight: 203.19 g/mol

Ref: 3D-XAA08689