CAS 22089-17-4
:N,N-bis(2-chloroethyl)-3-methyl-1,3,2-oxazaphosphinan-2-amine 2-oxide
Description:
N,N-bis(2-chloroethyl)-3-methyl-1,3,2-oxazaphosphinan-2-amine 2-oxide, commonly referred to by its CAS number 22089-17-4, is a chemical compound that belongs to the class of oxazaphosphorines. This substance features a unique structure that includes a phosphorus atom bonded to an oxazaphosphorine ring, which is further substituted with two chloroethyl groups and a methyl group. The presence of the chloroethyl groups suggests potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in medicinal chemistry and as a potential alkylating agent. The compound is characterized by its ability to form stable complexes and may exhibit biological activity, including antitumor properties. Its solubility and stability can vary depending on the solvent and environmental conditions. Safety data indicates that it should be handled with care due to potential toxicity associated with its chloroethyl substituents. Overall, this compound represents a significant area of study in the development of pharmaceuticals and agrochemicals.
Formula:C8H17Cl2N2O2P
InChI:InChI=1/C8H17Cl2N2O2P/c1-11-5-2-8-14-15(11,13)12(6-3-9)7-4-10/h2-8H2,1H3
SMILES:CN1CCCOP1(=O)N(CCCl)CCCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cyclophosphamide Impurity 31
CAS:Formula:C8H17Cl2N2O2PColor and Shape:White To Off-White Semi-SolidMolecular weight:275.11N-Methyl cyclophosphamide
CAS:<p>N-Methyl cyclophosphamide is an analog of the anticancer drug cyclophosphamide, which is used to treat various types of cancer. It works by inhibiting the activity of certain kinases that are involved in tumor growth and progression. N-Methyl cyclophosphamide has been shown to induce apoptosis in cancer cells, leading to their death. This medicinal compound can be used as a potent inhibitor of protein kinases, making it a promising candidate for developing new anticancer therapies. N-Methyl cyclophosphamide is excreted in urine and has been studied extensively in Chinese patients with different types of cancer. Its ability to inhibit kinase activity makes it a promising tool for developing targeted therapies against a variety of cancers.</p>Formula:C8H17Cl2N2O2PPurity:Min. 95%Molecular weight:275.11 g/mol


