CAS 22090-27-3: 4-pyrrolidin-1-ylbenzoic acid

Description:4-Pyrrolidin-1-ylbenzoic acid, identified by its CAS number 22090-27-3, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a pyrrolidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its potential applications in medicinal chemistry and drug development. The pyrrolidine ring enhances its ability to interact with biological targets, while the carboxylic acid functional group can participate in hydrogen bonding and ionic interactions. As a result, 4-pyrrolidin-1-ylbenzoic acid may exhibit interesting pharmacological properties, including anti-inflammatory or analgesic effects. Its solubility profile is influenced by the presence of the polar carboxylic acid group, which can enhance solubility in polar solvents. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the aromatic ring and the steric hindrance introduced by the pyrrolidine substituent. Overall, 4-pyrrolidin-1-ylbenzoic acid represents a versatile structure with potential utility in various chemical and biological applications.

Formula:C₁₁H₁₃NO₂

InChI:InChI=1/C11H13NO2/c13-11(14)9-3-5-10(6-4-9)12-7-1-2-8-12/h3-6H,1-2,7-8H2,(H,13,14)

Synonyms:
4-(Pyrrolidin-1-yl)benzoic acid
Benzoic acid, 4-(1-pyrrolidinyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-(1-PYRROLIDINYL)BENZOIC ACID REF: IN-DA0070C9CAS: 22090-27-3	98%	26.00 €~474.00 €	Fri 28 Mar 25
4-(Pyrrolidin-1-yl)benzoic acid REF: 54-OR14246CAS: 22090-27-3	By hplc: 99% (Typical Value in Batch COA)	32.00 €~378.00 €	Fri 04 Apr 25
4-Pyrrolidin-1-yl-benzoic acid REF: 10-F059513CAS: 22090-27-3	95.0%	To inquire	Mon 07 Apr 25
4-(1-Pyrrolidinyl)benzoic acid REF: 3D-FP54273CAS: 22090-27-3	Min. 95%	- - -	Discontinued product