CAS 22091-36-7

4-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole

Description:

4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole, with the CAS number 22091-36-7, is a heterocyclic organic compound characterized by the presence of both an oxazole ring and chloromethyl and chlorophenyl substituents. The oxazole ring consists of a five-membered aromatic structure containing both nitrogen and oxygen atoms, contributing to its potential reactivity and biological activity. The chloromethyl group enhances the compound's electrophilic character, making it useful in various chemical reactions, while the 4-chlorophenyl substituent can influence its lipophilicity and interaction with biological targets. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₇Cl₂NO

InChI: InChI=1/C10H7Cl2NO/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2

SMILES: c1cc(ccc1c1nc(CCl)co1)Cl

4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole

CAS: 22091-36-7

Versatile small molecule scaffold

Formula: C₁₀H₇Cl₂NO

Purity: Min. 95%

Molecular weight: 228.07 g/mol

Ref: 3D-XAA09136