CAS 220914-34-1

(2E)-3-[4-[3-(Dimethylamino)propoxy]phenyl]-2-propenoic acid

Description:

The chemical substance known as (2E)-3-[4-[3-(Dimethylamino)propoxy]phenyl]-2-propenoic acid, with the CAS number 220914-34-1, is an organic compound characterized by its propenoic acid backbone, which features a phenyl group substituted with a propoxy chain containing a dimethylamino group. This structure suggests that it may exhibit both acidic and basic properties due to the presence of the carboxylic acid functional group and the dimethylamino moiety, respectively. The compound is likely to be soluble in polar solvents, given the presence of the hydrophilic carboxylic acid and the dimethylamino group, while the phenyl and propoxy components may contribute to hydrophobic interactions. Its potential applications could span various fields, including pharmaceuticals and materials science, where it may serve as a building block for more complex molecules or as an active ingredient in drug formulations. The specific reactivity and stability of this compound would depend on environmental conditions such as pH and temperature, as well as the presence of other reactive species.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c1-15(2)10-3-11-18-13-7-4-12(5-8-13)6-9-14(16)17/h4-9H,3,10-11H2,1-2H3,(H,16,17)/b9-6+

InChI key: InChIKey=VAURYHOHNGKAIZ-RMKNXTFCSA-N

SMILES: C(=C/C(O)=O)\C1=CC=C(OCCCN(C)C)C=C1

Synonyms:

• (2E)-3-[4-[3-(Dimethylamino)propoxy]phenyl]-2-propenoic acid
• 2-Propenoic acid, 3-[4-[3-(dimethylamino)propoxy]phenyl]-, (2E)-