CAS 22094-61-7
:5-amino-1,2-benzothiazol-3(2H)-one 1,1-dioxide
Description:
5-Amino-1,2-benzothiazol-3(2H)-one 1,1-dioxide, with the CAS number 22094-61-7, is a heterocyclic organic compound characterized by its benzothiazole structure, which incorporates both sulfur and nitrogen in its ring system. This compound features an amino group (-NH2) and a sulfonyl group (S=O) that contribute to its reactivity and solubility properties. It is typically a crystalline solid, exhibiting moderate stability under standard conditions. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and pharmaceutical applications. Additionally, the sulfonyl group enhances its polarity, which can influence its solubility in various solvents. The compound may exhibit biological activity, including antimicrobial or antitumor properties, although specific activities would depend on further empirical studies. Overall, 5-amino-1,2-benzothiazol-3(2H)-one 1,1-dioxide is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C7H6N2O3S
InChI:InChI=1/C7H6N2O3S/c8-4-1-2-6-5(3-4)7(10)9-13(6,11)12/h1-3H,8H2,(H,9,10)
SMILES:c1cc2c(cc1N)C(=NS2(=O)=O)O
Synonyms:- 1,2-Benzisothiazol-3(2H)-one, 5-amino-, 1,1-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Amino-1,2-benzisothiazol-3(2H)-one 1,1-dioxide
CAS:Formula:C7H6N2O3SPurity:97%Color and Shape:SolidMolecular weight:198.19915-AMINO-1,2-BENZISOTHIAZOL-3-(2H)-ONE 1,1-DIOXIDE
CAS:Formula:C7H6N2O3SPurity:95.0%Molecular weight:198.25-Amino-2,3-dihydro-1,2-benzothiazole-1,1,3-trione
CAS:5-Amino-2,3-dihydro-1,2-benzothiazole-1,1,3-trione is a nitro compound that has been shown to have toxin and sweet taste activity. 5-Amino-2,3-dihydro-1,2-benzothiazole-1,1,3-trione is used in the analysis of sweeteners in food products. It is also used as an intermediate in the synthesis of other compounds. 5AMT has been shown to be mutagenic and cytotoxic in some assays.Formula:C7H6N2O3SPurity:Min. 95%Molecular weight:198.2 g/mol


