CAS 22094-62-8

6-amino-1,2-benzothiazol-3(2H)-one 1,1-dioxide

Description:

6-Amino-1,2-benzothiazol-3(2H)-one 1,1-dioxide, also known by its CAS number 22094-62-8, is a heterocyclic organic compound characterized by the presence of a benzothiazole ring system. This compound features an amino group at the 6-position and a sulfonyl group, which contributes to its stability and solubility in various solvents. It typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the amino group allows for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, the sulfonyl moiety enhances its reactivity and interaction with biological targets. The compound is generally stable under standard conditions but may require careful handling due to its potential reactivity. Its unique structure and functional groups make it of interest in medicinal chemistry and materials science, where it may exhibit properties such as antimicrobial or anti-inflammatory activities.

Formula: C₇H₆N₂O₃S

InChI: InChI=1/C7H6N2O3S/c8-4-1-2-5-6(3-4)13(11,12)9-7(5)10/h1-3H,8H2,(H,9,10)

InChI key: InChIKey=SSRKZHLPNHLAKM-UHFFFAOYSA-N

SMILES: c1cc2c(cc1N)S(=O)(=O)N=C2O

Synonyms:

• (2,3-Dihydro-1,1,3-trioxobenzoisothiazol-6-yl)amine
• 1,2-Benzisothiazol-3(2H)-one, 6-amino-, 1,1-dioxide
• 6-Aminobenzo[d]isothiazol-3(2H)-one-1,1-dioxide
• 6-Aminosaccharin
• Saccharin, 6-amino-

6-Aminosaccharin

CAS: 22094-62-8

Formula: C₇H₆N₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.1991

Ref: IN-DA0039KE

6-Aminosaccharin

CAS: 22094-62-8

6-Aminosaccharin

Purity: 98%

Molecular weight: 198.20g/mol

Ref: 54-OR1011983

6-AMINO-1,1-DIOXO-1,2-BENZOTHIAZOL-3-ONE

CAS: 22094-62-8

Formula: C₇H₆N₂O₃S

Purity: 98%+

Molecular weight: 198.2

Ref: 10-F533473

6-Amino-1,1-dioxo-1,2-benzothiazol-3-one

CAS: 22094-62-8

6-Amino-1,1-dioxo-1,2-benzothiazol-3-one (6ABT) is a diazo compound that has been used in the synthesis of bioconjugates. 6ABT is an intermediate for the preparation of monoclonal antibodies and as an inhibitor of carbonic anhydrase II. 6ABT has been shown to have anti-cancer properties by inhibiting proliferation and inducing apoptosis in human cancer cells. It also inhibits cell growth in human colon cancer cells and human breast cancer cells. 6ABT has been found to inhibit the diphenolase activity of beta-hexosaminidase and alpha-glucosidase, which are enzymes that break down proteins and carbohydrates respectively. This inhibition may lead to metabolic disorders such as diabetes mellitus type 2.

Formula: C₇H₆N₂O₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 198.19 g/mol

Ref: 3D-XAA09462