CAS 220941-93-5

5-Fluoro-2-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-1H-indole

Description:

5-Fluoro-2-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-1H-indole is a chemical compound characterized by its complex structure, which includes an indole core substituted with a fluorine atom and a piperazine moiety linked through a methyl group. This compound exhibits properties typical of indole derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the piperazine ring is often associated with pharmacological effects, including anxiolytic and antipsychotic activities. The pyridine group contributes to the compound's ability to interact with various biological targets, potentially influencing its pharmacodynamics. As a result, this compound may be investigated for its therapeutic potential in treating various conditions, particularly in the realm of neuropharmacology. Its specific interactions and efficacy would depend on further empirical studies and characterization in biological systems.

Formula: C₁₈H₁₉FN₄

InChI: InChI=1S/C18H19FN4/c19-15-4-5-17-14(11-15)12-16(21-17)13-22-7-9-23(10-8-22)18-3-1-2-6-20-18/h1-6,11-12,21H,7-10,13H2

InChI key: InChIKey=PQOIDBZLMJMYCD-UHFFFAOYSA-N

SMILES: C(C=1NC=2C(C1)=CC(F)=CC2)N3CCN(CC3)C4=CC=CC=N4

Synonyms:

• 5-Fluoro-2-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-1H-indole
• 1H-Indole, 5-fluoro-2-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-
• CP 226269

CP-226269

CAS: 220941-93-5

CP-226269

Purity: ≥98%

Molecular weight: 310.37g/mol

Ref: 54-BUP03470

CP-226269

CAS: 220941-93-5

Formula: C₁₈H₁₉FN₄

Molecular weight: 310.37

Ref: 7W-GK9581

CP-226269

CAS: 220941-93-5

CP-226269 is a synthetic glucocorticoid, which is a type of steroid hormone. This compound is derived from chemical synthesis, originating from laboratories dedicated to the development of advanced biomolecules for research. Its mode of action involves binding to glucocorticoid receptors, which are part of the nuclear receptor superfamily. Once bound, it modulates the expression of target genes that play pivotal roles in inflammation, immune response, and metabolic processes.

Formula: C₁₈H₁₉FN₄

Purity: Min. 95%

Molecular weight: 310.37 g/mol

Ref: 3D-VIA94193

CP-226269

CAS: 220941-93-5

CP-226269 is a potent dopamine D4 receptor agonist that regulates calcium flux and has an EC50 value of 32.0 nM.

Formula: C₁₈H₁₉FN₄

Purity: 99.08%

Color and Shape: Solid

Molecular weight: 310.37

Ref: TM-T27060