CAS 220943-57-7

B-[3,5-Difluoro-4-(trifluoromethoxy)phenyl]boronic acid

Description:

B-[3,5-Difluoro-4-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both difluoro and trifluoromethoxy groups. This compound typically exhibits properties such as high thermal stability and solubility in organic solvents, making it useful in various chemical applications, including organic synthesis and medicinal chemistry. The presence of fluorine atoms enhances its lipophilicity and can influence its reactivity and interaction with biological targets. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is significant in the development of sensors and drug delivery systems. Additionally, this compound may play a role in Suzuki coupling reactions, a key method in the formation of carbon-carbon bonds in organic synthesis. Its unique structural features contribute to its potential utility in pharmaceuticals and materials science.

Formula: C₇H₄BF₅O₃

InChI: InChI=1S/C7H4BF5O3/c9-4-1-3(8(14)15)2-5(10)6(4)16-7(11,12)13/h1-2,14-15H

InChI key: InChIKey=FHNKCNRVDBWLJQ-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(F)C=C(B(O)O)C=C1F

Synonyms:

• Boronic acid, [3,5-difluoro-4-(trifluoromethoxy)phenyl]-
• 3,5-Difluoro-4-(trifluoromethoxy)phenylboronic acid
• [3,5-Difluoro-4-(trifluoromethoxy)phenyl]boronic acid
• B-[3,5-Difluoro-4-(trifluoromethoxy)phenyl]boronic acid
• Boronic acid, B-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-

3,5-difluoro-4-(trifluoroMethoxy)phenylboronic acid

CAS: 220943-57-7

Formula: C₇H₄BF₅O₃

Molecular weight: 241.9079

Ref: IN-DA00I4BZ

3,5-Difluoro-4-(trifluoromethoxy)phenylboronic acid

CAS: 220943-57-7

3,5-Difluoro-4-(trifluoromethoxy)phenylboronic acid

Purity: 98%

Molecular weight: 241.91g/mol

Ref: 54-PC900806