CAS 22097-10-5
:5-methyl-1,2,3-thiadiazole-4-carboxylic acid
Description:
5-Methyl-1,2,3-thiadiazole-4-carboxylic acid is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. The structure features a methyl group at the 5-position and a carboxylic acid functional group at the 4-position, contributing to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. It exhibits potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The thiadiazole ring system is known for its diverse reactivity, allowing for further functionalization and derivatization. Additionally, the compound's unique structure may impart specific interactions with biological targets, which can be explored for potential applications in drug development or as a biochemical tool. As with many heterocycles, the stability and reactivity of 5-methyl-1,2,3-thiadiazole-4-carboxylic acid can be influenced by environmental conditions such as pH and temperature.
Formula:C4H4N2O2S
InChI:InChI=1/C4H4N2O2S/c1-2-3(4(7)8)5-6-9-2/h1H3,(H,7,8)
SMILES:Cc1c(C(=O)O)nns1
Synonyms:- 1,2,3-Thiadiazole-4-Carboxylic Acid, 5-Methyl-
- 5-Methyl-1,2,3-thiadiazole-4-carboxylicacid
- 5-Methyl-1,2,3-thiadiazole-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methyl-1,2,3-thiadiazole-4-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:98%Color and Shape:SolidMolecular weight:144.15185-Methyl-1,2,3-thiadiazole-4-carboxylic acid
CAS:5-Methyl-1,2,3-thiadiazole-4-carboxylic acidPurity:98%5-Methyl-1,2,3-thiadiazole-4-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:98%Color and Shape:No data available.Molecular weight:144.155-Methyl-1,2,3-Thiadiazole-4-Carboxylic Acid
CAS:5-Methyl-1,2,3-thiadiazole-4-carboxylic acid is a carboxylic acid that is used as an adjuvant for agricultural purposes. It is used to increase the effectiveness of insecticides and acaricides. This material can be prepared by synthetic methods. 5-Methyl-1,2,3-thiadiazole-4-carboxylic acid is activated by carboxylic acids to form a reactive methyl ester. This activation increases the solubility and stability of this compound. 5MTT provides insecticidal activity with an attack on the insect's nervous system and prevents virus infection in plants by blocking viral replication.Formula:C4H4N2O2SPurity:Min. 95%Molecular weight:144.15 g/mol



