CAS 220996-80-5

4-Bromo-2-(trifluoromethoxy)benzaldehyde

Description:

4-Bromo-2-(trifluoromethoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a trifluoromethoxy group attached to a benzaldehyde moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as its boiling and melting points. The trifluoromethoxy group, consisting of a methoxy group (–OCH3) where three hydrogen atoms are replaced by fluorine atoms, significantly enhances the compound's electronegativity and lipophilicity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. This compound is typically a pale yellow to light brown solid at room temperature and is soluble in organic solvents. Its unique functional groups allow for potential applications in synthesis and as an intermediate in the production of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and fluorine.

Formula: C₈H₄BrF₃O₂

InChI: InChI=1/C8H4BrF3O2/c9-6-2-1-5(4-13)7(3-6)14-8(10,11)12/h1-4H

SMILES: c1cc(cc(c1C=O)OC(F)(F)F)Br

Synonyms:

• Benzaldehyde, 4-Bromo-2-(Trifluoromethoxy)-

4-Bromo-2-(trifluoromethoxy)benzaldehyde

CAS: 220996-80-5

Formula: C₈H₄BrF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 269.0154

Ref: IN-DA00709F

4-Bromo-2-(trifluoromethoxy)benzaldehyde

CAS: 220996-80-5

4-Bromo-2-(trifluoromethoxy)benzaldehyde

Purity: 98%

Color and Shape: Solid

Molecular weight: 269.02g/mol

Ref: 54-PC49239

4-Bromo-2-(trifluoromethoxy)benzaldehyde

CAS: 220996-80-5

Formula: C₈H₄BrF₃O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 269.017

Ref: 10-F077849