CAS 221006-67-3

B-(4-Bromo-3-methylphenyl)boronic acid

Description:

B-(4-Bromo-3-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with a bromine atom and a methyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents like methanol and ethanol, and showing limited solubility in water. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, which are valuable in organic synthesis for forming carbon-carbon bonds. The bromine substituent enhances its reactivity and can facilitate further functionalization. Additionally, the methyl group can influence the electronic properties and sterics of the molecule, affecting its reactivity and interactions in chemical processes. Overall, B-(4-Bromo-3-methylphenyl)boronic acid is a versatile compound used in synthetic organic chemistry and materials science.

Formula: C₇H₈BBrO₂

InChI: InChI=1S/C7H8BBrO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3

InChI key: InChIKey=WATLRNVCMDWRNM-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(C)=C(Br)C=C1

Synonyms:

• Boronic acid, B-(4-bromo-3-methylphenyl)-
• B-(4-Bromo-3-methylphenyl)boronic acid
• 4-Bromo-3-methylphenylboronic acid
• Boronic acid, (4-bromo-3-methylphenyl)-

4-Bromo-3-methylphenylboronic acid

CAS: 221006-67-3

Formula: C₇H₈BBrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.8522

Ref: IN-DA00BIF5

4-Bromo-3-methylphenylboronic acid

CAS: 221006-67-3

4-Bromo-3-methylphenylboronic acid

Purity: 98%

Molecular weight: 214.85g/mol

Ref: 54-OR360232

(4-Bromo-3-methylphenyl)boronic acid

CAS: 221006-67-3

Formula: C₇H₈BBrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.85

Ref: 10-F231147