CAS 221006-70-8
:2,6-Dimethoxypyridine-3-boronic acid
Description:
2,6-Dimethoxypyridine-3-boronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with two methoxy groups at the 2 and 6 positions and a boronic acid functional group at the 3 position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group, which can form hydrogen bonds. It is often used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a boron source for the formation of carbon-carbon bonds. The methoxy groups enhance the electron density of the pyridine ring, influencing its reactivity and stability. Additionally, the compound may exhibit properties such as moderate acidity due to the boronic acid group, which can participate in various chemical reactions, including coordination with Lewis bases. Overall, 2,6-Dimethoxypyridine-3-boronic acid is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C7H10BNO4
InChI:InChI=1/C7H10BNO4/c1-12-6-4-3-5(8(10)11)7(9-6)13-2/h3-4,10-11H,1-2H3
SMILES:COc1ccc(c(n1)OC)B(O)O
Synonyms:- (2,6-Dimethoxypyridin-3-yl)boronic acid
- 2,6-Dimethoxy-3-pyridineboronic acid
- Boronic acid, B-(2,6-dimethoxy-3-pyridinyl)-
- T6Nj Bo1 Cbqq Fo1 [Wln]
- 2,6-Dimethoxypyridin-3-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,6-Dimethoxypyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H10BNO4Purity:97.0 to 110.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:182.972,6-Dimethoxypyridin-3-ylboronic acid
CAS:Formula:C7H10BNO4Purity:98%Color and Shape:SolidMolecular weight:182.96962,6-Dimethoxypyridine-3-boronic acid
CAS:2,6-Dimethoxypyridine-3-boronic acidFormula:C7H10BNO4Purity:≥95%Color and Shape: white powderMolecular weight:182.97g/mol2,6-Dimethoxypyridin-3-ylboronic acid
CAS:Formula:C7H10BNO4Purity:95%Color and Shape:SolidMolecular weight:182.97





