CAS 221037-98-5
:3-iodophenylboronic acid
Description:
3-Iodophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring that also contains an iodine substituent at the meta position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications, particularly in organic synthesis and medicinal chemistry. The iodine atom enhances its reactivity and can facilitate further functionalization or coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 3-iodophenylboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a widely used method for forming carbon-carbon bonds in organic synthesis. Its unique combination of functional groups allows for diverse applications in chemical research and development.
Formula:C6H6BIO2
InChI:InChI=1/C6H6BIO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H
SMILES:c1cc(cc(c1)I)B(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Iodobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H6BIO2Purity:97%Molecular weight:247.83Boronic acid, (3-iodophenyl)-
CAS:Formula:C6H6BIO2Purity:98%Color and Shape:SolidMolecular weight:247.8261



